C22H24N2O5S — CID 34066534
N-cyclopropyl-3-[(7,8-dimethyl-2-oxochromen-4-yl)methylamino]-4-methoxybenzenesulfonamide (PubChem CID 34066534) has the molecular formula C22H24N2O5S and a molecular weight of 428.51 g/mol. Its IUPAC name is N-cyclopropyl-3-[(7,8-dimethyl-2-oxochromen-4-yl)methylamino]-4-methoxybenzenesulfonamide.
| Compound Name | N-cyclopropyl-3-[(7,8-dimethyl-2-oxochromen-4-yl)methylamino]-4-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 34066534 |
| Molecular Formula | C22H24N2O5S |
| Molecular Weight | 428.51 g/mol |
| Exact Mass | 428.14 |
| IUPAC Name | N-cyclopropyl-3-[(7,8-dimethyl-2-oxochromen-4-yl)methylamino]-4-methoxybenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)NC2CC2)cc1NCc1cc(=O)oc2c(C)c(C)ccc12 |
| InChI | InChI=1S/C22H24N2O5S/c1-13-4-8-18-15(10-21(25)29-22(18)14(13)2)12-23-19-11-17(7-9-20(19)28-3)30(26,27)24-16-5-6-16/h4,7-11,16,23-24H,5-6,12H2,1-3H3 |
| InChIKey | NDUPOQBQCYMNSJ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.51 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|