C18H15NO5 — CID 3538080
7,8-dimethyl-4-[(4-nitrophenoxy)methyl]chromen-2-one (PubChem CID 3538080) has the molecular formula C18H15NO5 and a molecular weight of 325.32 g/mol. Its IUPAC name is 7,8-dimethyl-4-[(4-nitrophenoxy)methyl]chromen-2-one.
| Compound Name | 7,8-dimethyl-4-[(4-nitrophenoxy)methyl]chromen-2-one |
|---|---|
| PubChem CID | 3538080 |
| Molecular Formula | C18H15NO5 |
| Molecular Weight | 325.32 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | 7,8-dimethyl-4-[(4-nitrophenoxy)methyl]chromen-2-one |
| SMILES | Cc1ccc2c(COc3ccc([N+](=O)[O-])cc3)cc(=O)oc2c1C |
| InChI | InChI=1S/C18H15NO5/c1-11-3-8-16-13(9-17(20)24-18(16)12(11)2)10-23-15-6-4-14(5-7-15)19(21)22/h3-9H,10H2,1-2H3 |
| InChIKey | KVLLSJNFDBZMST-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 82.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.32 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|