C19H19N3O6 — CID 2547536
(7,8-dimethyl-2-oxochromen-4-yl)methyl 2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetate (PubChem CID 2547536) has the molecular formula C19H19N3O6 and a molecular weight of 385.38 g/mol. Its IUPAC name is (7,8-dimethyl-2-oxochromen-4-yl)methyl 2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetate.
| Compound Name | (7,8-dimethyl-2-oxochromen-4-yl)methyl 2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetate |
|---|---|
| PubChem CID | 2547536 |
| Molecular Formula | C19H19N3O6 |
| Molecular Weight | 385.38 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | (7,8-dimethyl-2-oxochromen-4-yl)methyl 2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetate |
| SMILES | Cc1ccc2c(COC(=O)Cn3nc(C)c([N+](=O)[O-])c3C)cc(=O)oc2c1C |
| InChI | InChI=1S/C19H19N3O6/c1-10-5-6-15-14(7-16(23)28-19(15)11(10)2)9-27-17(24)8-21-13(4)18(22(25)26)12(3)20-21/h5-7H,8-9H2,1-4H3 |
| InChIKey | ZSPWASXOWGPLBU-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 117.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.38 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|