C21H20N4O6 — CID 4261016
(7,8-dimethyl-2-oxochromen-4-yl)methyl 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetate (PubChem CID 4261016) has the molecular formula C21H20N4O6 and a molecular weight of 424.41 g/mol. Its IUPAC name is (7,8-dimethyl-2-oxochromen-4-yl)methyl 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetate.
| Compound Name | (7,8-dimethyl-2-oxochromen-4-yl)methyl 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetate |
|---|---|
| PubChem CID | 4261016 |
| Molecular Formula | C21H20N4O6 |
| Molecular Weight | 424.41 g/mol |
| Exact Mass | 424.14 |
| IUPAC Name | (7,8-dimethyl-2-oxochromen-4-yl)methyl 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetate |
| SMILES | Cc1ccc2c(COC(=O)Cn3cnc4c3c(=O)n(C)c(=O)n4C)cc(=O)oc2c1C |
| InChI | InChI=1S/C21H20N4O6/c1-11-5-6-14-13(7-15(26)31-18(14)12(11)2)9-30-16(27)8-25-10-22-19-17(25)20(28)24(4)21(29)23(19)3/h5-7,10H,8-9H2,1-4H3 |
| InChIKey | JNPLFZXWYYOIOZ-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 118.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.41 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|