C18H16N4O5 — CID 40666106
7-[(7-hydroxy-8-methyl-2-oxochromen-4-yl)methyl]-1,3-dimethylpurine-2,6-dione (PubChem CID 40666106) has the molecular formula C18H16N4O5 and a molecular weight of 368.35 g/mol. Its IUPAC name is 7-[(7-hydroxy-8-methyl-2-oxochromen-4-yl)methyl]-1,3-dimethylpurine-2,6-dione.
| Compound Name | 7-[(7-hydroxy-8-methyl-2-oxochromen-4-yl)methyl]-1,3-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 40666106 |
| Molecular Formula | C18H16N4O5 |
| Molecular Weight | 368.35 g/mol |
| Exact Mass | 368.11 |
| IUPAC Name | 7-[(7-hydroxy-8-methyl-2-oxochromen-4-yl)methyl]-1,3-dimethylpurine-2,6-dione |
| SMILES | Cc1c(O)ccc2c(Cn3cnc4c3c(=O)n(C)c(=O)n4C)cc(=O)oc12 |
| InChI | InChI=1S/C18H16N4O5/c1-9-12(23)5-4-11-10(6-13(24)27-15(9)11)7-22-8-19-16-14(22)17(25)21(3)18(26)20(16)2/h4-6,8,23H,7H2,1-3H3 |
| InChIKey | ZGJHMRSWWYOADU-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 112.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.35 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|