C21H19N7O5 — CID 155548843
7-[[1-[(6-methoxy-2-oxochromen-4-yl)methyl]triazol-4-yl]methyl]-1,3-dimethylpurine-2,6-dione (PubChem CID 155548843) has the molecular formula C21H19N7O5 and a molecular weight of 449.43 g/mol. Its IUPAC name is 7-[[1-[(6-methoxy-2-oxochromen-4-yl)methyl]triazol-4-yl]methyl]-1,3-dimethylpurine-2,6-dione.
| Compound Name | 7-[[1-[(6-methoxy-2-oxochromen-4-yl)methyl]triazol-4-yl]methyl]-1,3-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 155548843 |
| Molecular Formula | C21H19N7O5 |
| Molecular Weight | 449.43 g/mol |
| Exact Mass | 449.14 |
| IUPAC Name | 7-[[1-[(6-methoxy-2-oxochromen-4-yl)methyl]triazol-4-yl]methyl]-1,3-dimethylpurine-2,6-dione |
| SMILES | COc1ccc2oc(=O)cc(Cn3cc(Cn4cnc5c4c(=O)n(C)c(=O)n5C)nn3)c2c1 |
| InChI | InChI=1S/C21H19N7O5/c1-25-19-18(20(30)26(2)21(25)31)27(11-22-19)9-13-10-28(24-23-13)8-12-6-17(29)33-16-5-4-14(32-3)7-15(12)16/h4-7,10-11H,8-9H2,1-3H3 |
| InChIKey | UJSMEQQGGHARDY-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 131.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.43 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|