C20H22NO2+ — CID 8877500
7,8-dimethyl-4-[(4-propylpyridin-1-ium-1-yl)methyl]chromen-2-one (PubChem CID 8877500) has the molecular formula C20H22NO2+ and a molecular weight of 308.40 g/mol. Its IUPAC name is 7,8-dimethyl-4-[(4-propylpyridin-1-ium-1-yl)methyl]chromen-2-one.
| Compound Name | 7,8-dimethyl-4-[(4-propylpyridin-1-ium-1-yl)methyl]chromen-2-one |
|---|---|
| PubChem CID | 8877500 |
| Molecular Formula | C20H22NO2+ |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | 7,8-dimethyl-4-[(4-propylpyridin-1-ium-1-yl)methyl]chromen-2-one |
| SMILES | CCCc1cc[n+](Cc2cc(=O)oc3c(C)c(C)ccc23)cc1 |
| InChI | InChI=1S/C20H22NO2/c1-4-5-16-8-10-21(11-9-16)13-17-12-19(22)23-20-15(3)14(2)6-7-18(17)20/h6-12H,4-5,13H2,1-3H3/q+1 |
| InChIKey | UQXJARAJBQSWEM-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 34.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|