C24H25N3O4 — CID 135809314
2-[[(7-ethyl-2-oxochromen-4-yl)methyl-(2-methoxyethyl)amino]methyl]-3H-quinazolin-4-one (PubChem CID 135809314) has the molecular formula C24H25N3O4 and a molecular weight of 419.48 g/mol. Its IUPAC name is 2-[[(7-ethyl-2-oxochromen-4-yl)methyl-(2-methoxyethyl)amino]methyl]-3H-quinazolin-4-one.
| Compound Name | 2-[[(7-ethyl-2-oxochromen-4-yl)methyl-(2-methoxyethyl)amino]methyl]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 135809314 |
| Molecular Formula | C24H25N3O4 |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.18 |
| IUPAC Name | 2-[[(7-ethyl-2-oxochromen-4-yl)methyl-(2-methoxyethyl)amino]methyl]-3H-quinazolin-4-one |
| SMILES | CCc1ccc2c(CN(CCOC)Cc3nc4ccccc4c(=O)[nH]3)cc(=O)oc2c1 |
| InChI | InChI=1S/C24H25N3O4/c1-3-16-8-9-18-17(13-23(28)31-21(18)12-16)14-27(10-11-30-2)15-22-25-20-7-5-4-6-19(20)24(29)26-22/h4-9,12-13H,3,10-11,14-15H2,1-2H3,(H,25,26,29) |
| InChIKey | HGGJMWBDKRPGND-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 88.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|