C19H27N5O4 — CID 135750989
N-(butylcarbamoyl)-2-[2-methoxyethyl-[(4-oxo-3H-quinazolin-2-yl)methyl]amino]acetamide (PubChem CID 135750989) has the molecular formula C19H27N5O4 and a molecular weight of 389.46 g/mol. Its IUPAC name is N-(butylcarbamoyl)-2-[2-methoxyethyl-[(4-oxo-3H-quinazolin-2-yl)methyl]amino]acetamide.
| Compound Name | N-(butylcarbamoyl)-2-[2-methoxyethyl-[(4-oxo-3H-quinazolin-2-yl)methyl]amino]acetamide |
|---|---|
| PubChem CID | 135750989 |
| Molecular Formula | C19H27N5O4 |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.21 |
| IUPAC Name | N-(butylcarbamoyl)-2-[2-methoxyethyl-[(4-oxo-3H-quinazolin-2-yl)methyl]amino]acetamide |
| SMILES | CCCCNC(=O)NC(=O)CN(CCOC)Cc1nc2ccccc2c(=O)[nH]1 |
| InChI | InChI=1S/C19H27N5O4/c1-3-4-9-20-19(27)23-17(25)13-24(10-11-28-2)12-16-21-15-8-6-5-7-14(15)18(26)22-16/h5-8H,3-4,9-13H2,1-2H3,(H,21,22,26)(H2,20,23,25,27) |
| InChIKey | BFNBDIFWLYOADM-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 116.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|