C20H30N5O3+ — CID 135750948
butyl-[2-(butylcarbamoylamino)-2-oxoethyl]-[(4-oxo-3H-quinazolin-2-yl)methyl]azanium (PubChem CID 135750948) has the molecular formula C20H30N5O3+ and a molecular weight of 388.49 g/mol. Its IUPAC name is butyl-[2-(butylcarbamoylamino)-2-oxoethyl]-[(4-oxo-3H-quinazolin-2-yl)methyl]azanium.
| Compound Name | butyl-[2-(butylcarbamoylamino)-2-oxoethyl]-[(4-oxo-3H-quinazolin-2-yl)methyl]azanium |
|---|---|
| PubChem CID | 135750948 |
| Molecular Formula | C20H30N5O3+ |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.23 |
| IUPAC Name | butyl-[2-(butylcarbamoylamino)-2-oxoethyl]-[(4-oxo-3H-quinazolin-2-yl)methyl]azanium |
| SMILES | CCCCNC(=O)NC(=O)C[NH+](CCCC)Cc1nc2ccccc2c(=O)[nH]1 |
| InChI | InChI=1S/C20H29N5O3/c1-3-5-11-21-20(28)24-18(26)14-25(12-6-4-2)13-17-22-16-10-8-7-9-15(16)19(27)23-17/h7-10H,3-6,11-14H2,1-2H3,(H,22,23,27)(H2,21,24,26,28)/p+1 |
| InChIKey | LYPRAQCLBMBPHS-UHFFFAOYSA-O |
| XLogP | 0.73 |
| TPSA | 108.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|