C19H29N4O2+ — CID 135809287
butyl-[2-(2-methylpropylamino)-2-oxoethyl]-[(4-oxo-3H-quinazolin-2-yl)methyl]azanium (PubChem CID 135809287) has the molecular formula C19H29N4O2+ and a molecular weight of 345.47 g/mol. Its IUPAC name is butyl-[2-(2-methylpropylamino)-2-oxoethyl]-[(4-oxo-3H-quinazolin-2-yl)methyl]azanium.
| Compound Name | butyl-[2-(2-methylpropylamino)-2-oxoethyl]-[(4-oxo-3H-quinazolin-2-yl)methyl]azanium |
|---|---|
| PubChem CID | 135809287 |
| Molecular Formula | C19H29N4O2+ |
| Molecular Weight | 345.47 g/mol |
| Exact Mass | 345.23 |
| IUPAC Name | butyl-[2-(2-methylpropylamino)-2-oxoethyl]-[(4-oxo-3H-quinazolin-2-yl)methyl]azanium |
| SMILES | CCCC[NH+](CC(=O)NCC(C)C)Cc1nc2ccccc2c(=O)[nH]1 |
| InChI | InChI=1S/C19H28N4O2/c1-4-5-10-23(13-18(24)20-11-14(2)3)12-17-21-16-9-7-6-8-15(16)19(25)22-17/h6-9,14H,4-5,10-13H2,1-3H3,(H,20,24)(H,21,22,25)/p+1 |
| InChIKey | JMQUEEPMBUJVDV-UHFFFAOYSA-O |
| XLogP | 0.88 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.47 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |