C18H23ClNO2- — CID 53352370
5,7-dimethyl-4-[(2-methylpiperidin-1-yl)methyl]chromen-2-one chloride (PubChem CID 53352370) has the molecular formula C18H23ClNO2- and a molecular weight of 320.84 g/mol. Its IUPAC name is 5,7-dimethyl-4-[(2-methylpiperidin-1-yl)methyl]chromen-2-one chloride.
| Compound Name | 5,7-dimethyl-4-[(2-methylpiperidin-1-yl)methyl]chromen-2-one chloride |
|---|---|
| PubChem CID | 53352370 |
| Molecular Formula | C18H23ClNO2- |
| Molecular Weight | 320.84 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | 5,7-dimethyl-4-[(2-methylpiperidin-1-yl)methyl]chromen-2-one chloride |
| SMILES | Cc1cc(C)c2c(CN3CCCCC3C)cc(=O)oc2c1.[Cl-] |
| InChI | InChI=1S/C18H23NO2.ClH/c1-12-8-13(2)18-15(10-17(20)21-16(18)9-12)11-19-7-5-4-6-14(19)3;/h8-10,14H,4-7,11H2,1-3H3;1H/p-1 |
| InChIKey | CEFUUOWAFVPQFG-UHFFFAOYSA-M |
| XLogP | 0.79 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.84 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|