C20H19Cl2FNO2+ — CID 9377229
[(1S)-1-(2,4-dichloro-5-fluorophenyl)ethyl]-[(6,7-dimethyl-2-oxochromen-4-yl)methyl]azanium (PubChem CID 9377229) has the molecular formula C20H19Cl2FNO2+ and a molecular weight of 395.28 g/mol. Its IUPAC name is [(1S)-1-(2,4-dichloro-5-fluorophenyl)ethyl]-[(6,7-dimethyl-2-oxochromen-4-yl)methyl]azanium.
| Compound Name | [(1S)-1-(2,4-dichloro-5-fluorophenyl)ethyl]-[(6,7-dimethyl-2-oxochromen-4-yl)methyl]azanium |
|---|---|
| PubChem CID | 9377229 |
| Molecular Formula | C20H19Cl2FNO2+ |
| Molecular Weight | 395.28 g/mol |
| Exact Mass | 394.08 |
| IUPAC Name | [(1S)-1-(2,4-dichloro-5-fluorophenyl)ethyl]-[(6,7-dimethyl-2-oxochromen-4-yl)methyl]azanium |
| SMILES | Cc1cc2oc(=O)cc(C[NH2+][C@@H](C)c3cc(F)c(Cl)cc3Cl)c2cc1C |
| InChI | InChI=1S/C20H18Cl2FNO2/c1-10-4-15-13(6-20(25)26-19(15)5-11(10)2)9-24-12(3)14-7-18(23)17(22)8-16(14)21/h4-8,12,24H,9H2,1-3H3/p+1/t12-/m0/s1 |
| InChIKey | CWMFLPBXVHOUFH-LBPRGKRZSA-O |
| XLogP | 4.68 |
| TPSA | 46.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.28 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|