C27H27N3O4S — CID 55427576
6-[4-oxo-2-[(2-oxo-7,8-dihydro-6H-cyclopenta[g]chromen-4-yl)methylsulfanyl]quinazolin-3-yl]hexanamide (PubChem CID 55427576) has the molecular formula C27H27N3O4S and a molecular weight of 489.60 g/mol. Its IUPAC name is 6-[4-oxo-2-[(2-oxo-7,8-dihydro-6H-cyclopenta[g]chromen-4-yl)methylsulfanyl]quinazolin-3-yl]hexanamide.
| Compound Name | 6-[4-oxo-2-[(2-oxo-7,8-dihydro-6H-cyclopenta[g]chromen-4-yl)methylsulfanyl]quinazolin-3-yl]hexanamide |
|---|---|
| PubChem CID | 55427576 |
| Molecular Formula | C27H27N3O4S |
| Molecular Weight | 489.60 g/mol |
| Exact Mass | 489.17 |
| IUPAC Name | 6-[4-oxo-2-[(2-oxo-7,8-dihydro-6H-cyclopenta[g]chromen-4-yl)methylsulfanyl]quinazolin-3-yl]hexanamide |
| SMILES | NC(=O)CCCCCn1c(SCc2cc(=O)oc3cc4c(cc23)CCC4)nc2ccccc2c1=O |
| InChI | InChI=1S/C27H27N3O4S/c28-24(31)11-2-1-5-12-30-26(33)20-9-3-4-10-22(20)29-27(30)35-16-19-15-25(32)34-23-14-18-8-6-7-17(18)13-21(19)23/h3-4,9-10,13-15H,1-2,5-8,11-12,16H2,(H2,28,31) |
| InChIKey | PWAKNGNIIXTLLY-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 108.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.60 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|