C22H22ClN3O4S — CID 55473424
6-[2-[(7-chloro-1,3-benzodioxol-5-yl)methylsulfanyl]-4-oxoquinazolin-3-yl]hexanamide (PubChem CID 55473424) has the molecular formula C22H22ClN3O4S and a molecular weight of 459.96 g/mol. Its IUPAC name is 6-[2-[(7-chloro-1,3-benzodioxol-5-yl)methylsulfanyl]-4-oxoquinazolin-3-yl]hexanamide.
| Compound Name | 6-[2-[(7-chloro-1,3-benzodioxol-5-yl)methylsulfanyl]-4-oxoquinazolin-3-yl]hexanamide |
|---|---|
| PubChem CID | 55473424 |
| Molecular Formula | C22H22ClN3O4S |
| Molecular Weight | 459.96 g/mol |
| Exact Mass | 459.10 |
| IUPAC Name | 6-[2-[(7-chloro-1,3-benzodioxol-5-yl)methylsulfanyl]-4-oxoquinazolin-3-yl]hexanamide |
| SMILES | NC(=O)CCCCCn1c(SCc2cc(Cl)c3c(c2)OCO3)nc2ccccc2c1=O |
| InChI | InChI=1S/C22H22ClN3O4S/c23-16-10-14(11-18-20(16)30-13-29-18)12-31-22-25-17-7-4-3-6-15(17)21(28)26(22)9-5-1-2-8-19(24)27/h3-4,6-7,10-11H,1-2,5,8-9,12-13H2,(H2,24,27) |
| InChIKey | LDWQASVAWDIHFQ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 96.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.96 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|