C19H20ClN3O2S2 — CID 16510330
2-(7-chloro-4-oxo-3-propylquinazolin-2-yl)sulfanyl-N-(1-thiophen-2-ylethyl)acetamide (PubChem CID 16510330) has the molecular formula C19H20ClN3O2S2 and a molecular weight of 421.98 g/mol. Its IUPAC name is 2-(7-chloro-4-oxo-3-propylquinazolin-2-yl)sulfanyl-N-(1-thiophen-2-ylethyl)acetamide.
| Compound Name | 2-(7-chloro-4-oxo-3-propylquinazolin-2-yl)sulfanyl-N-(1-thiophen-2-ylethyl)acetamide |
|---|---|
| PubChem CID | 16510330 |
| Molecular Formula | C19H20ClN3O2S2 |
| Molecular Weight | 421.98 g/mol |
| Exact Mass | 421.07 |
| IUPAC Name | 2-(7-chloro-4-oxo-3-propylquinazolin-2-yl)sulfanyl-N-(1-thiophen-2-ylethyl)acetamide |
| SMILES | CCCn1c(SCC(=O)NC(C)c2cccs2)nc2cc(Cl)ccc2c1=O |
| InChI | InChI=1S/C19H20ClN3O2S2/c1-3-8-23-18(25)14-7-6-13(20)10-15(14)22-19(23)27-11-17(24)21-12(2)16-5-4-9-26-16/h4-7,9-10,12H,3,8,11H2,1-2H3,(H,21,24) |
| InChIKey | BLANIJBNAONJFB-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.98 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |