C22H20ClN3O2S — CID 4809917
2-[3-(4-chlorophenyl)-4-oxoquinazolin-2-yl]sulfanyl-N,N-bis(prop-2-enyl)acetamide (PubChem CID 4809917) has the molecular formula C22H20ClN3O2S and a molecular weight of 425.94 g/mol. Its IUPAC name is 2-[3-(4-chlorophenyl)-4-oxoquinazolin-2-yl]sulfanyl-N,N-bis(prop-2-enyl)acetamide.
| Compound Name | 2-[3-(4-chlorophenyl)-4-oxoquinazolin-2-yl]sulfanyl-N,N-bis(prop-2-enyl)acetamide |
|---|---|
| PubChem CID | 4809917 |
| Molecular Formula | C22H20ClN3O2S |
| Molecular Weight | 425.94 g/mol |
| Exact Mass | 425.10 |
| IUPAC Name | 2-[3-(4-chlorophenyl)-4-oxoquinazolin-2-yl]sulfanyl-N,N-bis(prop-2-enyl)acetamide |
| SMILES | C=CCN(CC=C)C(=O)CSc1nc2ccccc2c(=O)n1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H20ClN3O2S/c1-3-13-25(14-4-2)20(27)15-29-22-24-19-8-6-5-7-18(19)21(28)26(22)17-11-9-16(23)10-12-17/h3-12H,1-2,13-15H2 |
| InChIKey | DBBKATMOEUCNSI-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.94 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|