C18H20FN3O4 — CID 40743560
ethyl 1-[2-(7-fluoro-4-oxoquinazolin-3-yl)acetyl]piperidine-4-carboxylate (PubChem CID 40743560) has the molecular formula C18H20FN3O4 and a molecular weight of 361.37 g/mol. Its IUPAC name is ethyl 1-[2-(7-fluoro-4-oxoquinazolin-3-yl)acetyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[2-(7-fluoro-4-oxoquinazolin-3-yl)acetyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 40743560 |
| Molecular Formula | C18H20FN3O4 |
| Molecular Weight | 361.37 g/mol |
| Exact Mass | 361.14 |
| IUPAC Name | ethyl 1-[2-(7-fluoro-4-oxoquinazolin-3-yl)acetyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(=O)Cn2cnc3cc(F)ccc3c2=O)CC1 |
| InChI | InChI=1S/C18H20FN3O4/c1-2-26-18(25)12-5-7-21(8-6-12)16(23)10-22-11-20-15-9-13(19)3-4-14(15)17(22)24/h3-4,9,11-12H,2,5-8,10H2,1H3 |
| InChIKey | WMZOENWYRSNDEI-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 81.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.37 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |