C20H23F2N3O5 — CID 55374775
ethyl 1-[2-[4-(2,5-difluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]piperidine-4-carboxylate (PubChem CID 55374775) has the molecular formula C20H23F2N3O5 and a molecular weight of 423.42 g/mol. Its IUPAC name is ethyl 1-[2-[4-(2,5-difluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[2-[4-(2,5-difluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 55374775 |
| Molecular Formula | C20H23F2N3O5 |
| Molecular Weight | 423.42 g/mol |
| Exact Mass | 423.16 |
| IUPAC Name | ethyl 1-[2-[4-(2,5-difluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(=O)CN2C(=O)NC(C)(c3cc(F)ccc3F)C2=O)CC1 |
| InChI | InChI=1S/C20H23F2N3O5/c1-3-30-17(27)12-6-8-24(9-7-12)16(26)11-25-18(28)20(2,23-19(25)29)14-10-13(21)4-5-15(14)22/h4-5,10,12H,3,6-9,11H2,1-2H3,(H,23,29) |
| InChIKey | IPFGLYSVXRBCOP-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.42 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|