C20H27FN2O3 — CID 47019473
ethyl 1-[2-[2-(4-fluorophenyl)pyrrolidin-1-yl]acetyl]piperidine-4-carboxylate (PubChem CID 47019473) has the molecular formula C20H27FN2O3 and a molecular weight of 362.45 g/mol. Its IUPAC name is ethyl 1-[2-[2-(4-fluorophenyl)pyrrolidin-1-yl]acetyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[2-[2-(4-fluorophenyl)pyrrolidin-1-yl]acetyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 47019473 |
| Molecular Formula | C20H27FN2O3 |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | ethyl 1-[2-[2-(4-fluorophenyl)pyrrolidin-1-yl]acetyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(=O)CN2CCCC2c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C20H27FN2O3/c1-2-26-20(25)16-9-12-22(13-10-16)19(24)14-23-11-3-4-18(23)15-5-7-17(21)8-6-15/h5-8,16,18H,2-4,9-14H2,1H3 |
| InChIKey | PBGYZZJHYNGRDK-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |