C18H24BrN3O2 — CID 55829549
1-[2-[2-(4-bromophenyl)pyrrolidin-1-yl]acetyl]piperidine-4-carboxamide (PubChem CID 55829549) has the molecular formula C18H24BrN3O2 and a molecular weight of 394.31 g/mol. Its IUPAC name is 1-[2-[2-(4-bromophenyl)pyrrolidin-1-yl]acetyl]piperidine-4-carboxamide.
| Compound Name | 1-[2-[2-(4-bromophenyl)pyrrolidin-1-yl]acetyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55829549 |
| Molecular Formula | C18H24BrN3O2 |
| Molecular Weight | 394.31 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | 1-[2-[2-(4-bromophenyl)pyrrolidin-1-yl]acetyl]piperidine-4-carboxamide |
| SMILES | NC(=O)C1CCN(C(=O)CN2CCCC2c2ccc(Br)cc2)CC1 |
| InChI | InChI=1S/C18H24BrN3O2/c19-15-5-3-13(4-6-15)16-2-1-9-22(16)12-17(23)21-10-7-14(8-11-21)18(20)24/h3-6,14,16H,1-2,7-12H2,(H2,20,24) |
| InChIKey | LLZFNNKTAFUWEO-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.31 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |