C23H23FN4O3 — CID 46402429
N-benzyl-1-[2-(6-fluoro-4-oxoquinazolin-3-yl)acetyl]piperidine-4-carboxamide (PubChem CID 46402429) has the molecular formula C23H23FN4O3 and a molecular weight of 422.46 g/mol. Its IUPAC name is N-benzyl-1-[2-(6-fluoro-4-oxoquinazolin-3-yl)acetyl]piperidine-4-carboxamide.
| Compound Name | N-benzyl-1-[2-(6-fluoro-4-oxoquinazolin-3-yl)acetyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 46402429 |
| Molecular Formula | C23H23FN4O3 |
| Molecular Weight | 422.46 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | N-benzyl-1-[2-(6-fluoro-4-oxoquinazolin-3-yl)acetyl]piperidine-4-carboxamide |
| SMILES | O=C(NCc1ccccc1)C1CCN(C(=O)Cn2cnc3ccc(F)cc3c2=O)CC1 |
| InChI | InChI=1S/C23H23FN4O3/c24-18-6-7-20-19(12-18)23(31)28(15-26-20)14-21(29)27-10-8-17(9-11-27)22(30)25-13-16-4-2-1-3-5-16/h1-7,12,15,17H,8-11,13-14H2,(H,25,30) |
| InChIKey | XVWAQBVBPJMVAF-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.46 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |