C17H23F3N4O3S — CID 78896837
2-(4-pyridin-3-ylsulfonylpiperazin-1-yl)-1-[3-(trifluoromethyl)piperidin-1-yl]ethanone (PubChem CID 78896837) has the molecular formula C17H23F3N4O3S and a molecular weight of 420.46 g/mol. Its IUPAC name is 2-(4-pyridin-3-ylsulfonylpiperazin-1-yl)-1-[3-(trifluoromethyl)piperidin-1-yl]ethanone.
| Compound Name | 2-(4-pyridin-3-ylsulfonylpiperazin-1-yl)-1-[3-(trifluoromethyl)piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 78896837 |
| Molecular Formula | C17H23F3N4O3S |
| Molecular Weight | 420.46 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | 2-(4-pyridin-3-ylsulfonylpiperazin-1-yl)-1-[3-(trifluoromethyl)piperidin-1-yl]ethanone |
| SMILES | O=C(CN1CCN(S(=O)(=O)c2cccnc2)CC1)N1CCCC(C(F)(F)F)C1 |
| InChI | InChI=1S/C17H23F3N4O3S/c18-17(19,20)14-3-2-6-23(12-14)16(25)13-22-7-9-24(10-8-22)28(26,27)15-4-1-5-21-11-15/h1,4-5,11,14H,2-3,6-10,12-13H2 |
| InChIKey | YXUAWHCZLSXGTQ-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 73.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.46 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |