C14H19N5O3S — CID 39012931
N-(2-cyanoethyl)-2-(4-pyridin-3-ylsulfonylpiperazin-1-yl)acetamide (PubChem CID 39012931) has the molecular formula C14H19N5O3S and a molecular weight of 337.41 g/mol. Its IUPAC name is N-(2-cyanoethyl)-2-(4-pyridin-3-ylsulfonylpiperazin-1-yl)acetamide.
| Compound Name | N-(2-cyanoethyl)-2-(4-pyridin-3-ylsulfonylpiperazin-1-yl)acetamide |
|---|---|
| PubChem CID | 39012931 |
| Molecular Formula | C14H19N5O3S |
| Molecular Weight | 337.41 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | N-(2-cyanoethyl)-2-(4-pyridin-3-ylsulfonylpiperazin-1-yl)acetamide |
| SMILES | N#CCCNC(=O)CN1CCN(S(=O)(=O)c2cccnc2)CC1 |
| InChI | InChI=1S/C14H19N5O3S/c15-4-2-6-17-14(20)12-18-7-9-19(10-8-18)23(21,22)13-3-1-5-16-11-13/h1,3,5,11H,2,6-10,12H2,(H,17,20) |
| InChIKey | ZUAXIWRZBYEPBT-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 106.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.41 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|