C17H18F3N3O2S — CID 37067319
1-pyridin-3-ylsulfonyl-4-[[2-(trifluoromethyl)phenyl]methyl]piperazine (PubChem CID 37067319) has the molecular formula C17H18F3N3O2S and a molecular weight of 385.41 g/mol. Its IUPAC name is 1-pyridin-3-ylsulfonyl-4-[[2-(trifluoromethyl)phenyl]methyl]piperazine.
| Compound Name | 1-pyridin-3-ylsulfonyl-4-[[2-(trifluoromethyl)phenyl]methyl]piperazine |
|---|---|
| PubChem CID | 37067319 |
| Molecular Formula | C17H18F3N3O2S |
| Molecular Weight | 385.41 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | 1-pyridin-3-ylsulfonyl-4-[[2-(trifluoromethyl)phenyl]methyl]piperazine |
| SMILES | O=S(=O)(c1cccnc1)N1CCN(Cc2ccccc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C17H18F3N3O2S/c18-17(19,20)16-6-2-1-4-14(16)13-22-8-10-23(11-9-22)26(24,25)15-5-3-7-21-12-15/h1-7,12H,8-11,13H2 |
| InChIKey | IQWOSFBSOHSMSR-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.41 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |