C22H24F3N3O7S — CID 2902908
oxalic acid;N-[4-[4-[[2-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]sulfonylphenyl]acetamide (PubChem CID 2902908) has the molecular formula C22H24F3N3O7S and a molecular weight of 531.51 g/mol. Its IUPAC name is oxalic acid;N-[4-[4-[[2-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]sulfonylphenyl]acetamide.
| Compound Name | oxalic acid;N-[4-[4-[[2-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]sulfonylphenyl]acetamide |
|---|---|
| PubChem CID | 2902908 |
| Molecular Formula | C22H24F3N3O7S |
| Molecular Weight | 531.51 g/mol |
| Exact Mass | 531.13 |
| IUPAC Name | oxalic acid;N-[4-[4-[[2-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]sulfonylphenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)N2CCN(Cc3ccccc3C(F)(F)F)CC2)cc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C20H22F3N3O3S.C2H2O4/c1-15(27)24-17-6-8-18(9-7-17)30(28,29)26-12-10-25(11-13-26)14-16-4-2-3-5-19(16)20(21,22)23;3-1(4)2(5)6/h2-9H,10-14H2,1H3,(H,24,27);(H,3,4)(H,5,6) |
| InChIKey | UTZWOKXZDNEZSR-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 144.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.51 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|