C19H21F3N2O2S — CID 2171509
1-benzylsulfonyl-4-[[2-(trifluoromethyl)phenyl]methyl]piperazine (PubChem CID 2171509) has the molecular formula C19H21F3N2O2S and a molecular weight of 398.45 g/mol. Its IUPAC name is 1-benzylsulfonyl-4-[[2-(trifluoromethyl)phenyl]methyl]piperazine.
| Compound Name | 1-benzylsulfonyl-4-[[2-(trifluoromethyl)phenyl]methyl]piperazine |
|---|---|
| PubChem CID | 2171509 |
| Molecular Formula | C19H21F3N2O2S |
| Molecular Weight | 398.45 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | 1-benzylsulfonyl-4-[[2-(trifluoromethyl)phenyl]methyl]piperazine |
| SMILES | O=S(=O)(Cc1ccccc1)N1CCN(Cc2ccccc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C19H21F3N2O2S/c20-19(21,22)18-9-5-4-8-17(18)14-23-10-12-24(13-11-23)27(25,26)15-16-6-2-1-3-7-16/h1-9H,10-15H2 |
| InChIKey | HLODVXDGVPDCTG-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.45 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |