C17H24N4O2S — CID 22208310
1-benzylsulfonyl-4-[(1,5-dimethylpyrazol-4-yl)methyl]piperazine (PubChem CID 22208310) has the molecular formula C17H24N4O2S and a molecular weight of 348.47 g/mol. Its IUPAC name is 1-benzylsulfonyl-4-[(1,5-dimethylpyrazol-4-yl)methyl]piperazine.
| Compound Name | 1-benzylsulfonyl-4-[(1,5-dimethylpyrazol-4-yl)methyl]piperazine |
|---|---|
| PubChem CID | 22208310 |
| Molecular Formula | C17H24N4O2S |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | 1-benzylsulfonyl-4-[(1,5-dimethylpyrazol-4-yl)methyl]piperazine |
| SMILES | Cc1c(CN2CCN(S(=O)(=O)Cc3ccccc3)CC2)cnn1C |
| InChI | InChI=1S/C17H24N4O2S/c1-15-17(12-18-19(15)2)13-20-8-10-21(11-9-20)24(22,23)14-16-6-4-3-5-7-16/h3-7,12H,8-11,13-14H2,1-2H3 |
| InChIKey | RMDZFKSFKWXHRZ-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |