C15H21N5O2S — CID 126812465
1-benzylsulfonyl-4-(4,5-dimethyl-1,2,4-triazol-3-yl)piperazine (PubChem CID 126812465) has the molecular formula C15H21N5O2S and a molecular weight of 335.43 g/mol. Its IUPAC name is 1-benzylsulfonyl-4-(4,5-dimethyl-1,2,4-triazol-3-yl)piperazine.
| Compound Name | 1-benzylsulfonyl-4-(4,5-dimethyl-1,2,4-triazol-3-yl)piperazine |
|---|---|
| PubChem CID | 126812465 |
| Molecular Formula | C15H21N5O2S |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | 1-benzylsulfonyl-4-(4,5-dimethyl-1,2,4-triazol-3-yl)piperazine |
| SMILES | Cc1nnc(N2CCN(S(=O)(=O)Cc3ccccc3)CC2)n1C |
| InChI | InChI=1S/C15H21N5O2S/c1-13-16-17-15(18(13)2)19-8-10-20(11-9-19)23(21,22)12-14-6-4-3-5-7-14/h3-7H,8-12H2,1-2H3 |
| InChIKey | JBRCAUMOQZSWGY-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 71.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |