C18H23ClF3N3O — CID 87012618
2-[4-(2-chlorophenyl)piperazin-1-yl]-1-[3-(trifluoromethyl)piperidin-1-yl]ethanone (PubChem CID 87012618) has the molecular formula C18H23ClF3N3O and a molecular weight of 389.85 g/mol. Its IUPAC name is 2-[4-(2-chlorophenyl)piperazin-1-yl]-1-[3-(trifluoromethyl)piperidin-1-yl]ethanone.
| Compound Name | 2-[4-(2-chlorophenyl)piperazin-1-yl]-1-[3-(trifluoromethyl)piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 87012618 |
| Molecular Formula | C18H23ClF3N3O |
| Molecular Weight | 389.85 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | 2-[4-(2-chlorophenyl)piperazin-1-yl]-1-[3-(trifluoromethyl)piperidin-1-yl]ethanone |
| SMILES | O=C(CN1CCN(c2ccccc2Cl)CC1)N1CCCC(C(F)(F)F)C1 |
| InChI | InChI=1S/C18H23ClF3N3O/c19-15-5-1-2-6-16(15)24-10-8-23(9-11-24)13-17(26)25-7-3-4-14(12-25)18(20,21)22/h1-2,5-6,14H,3-4,7-13H2 |
| InChIKey | ACAQLHKFIAXONW-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.85 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |