C19H26ClN3O3 — CID 55353705
methyl 1-[2-[4-(2-chlorophenyl)piperazin-1-yl]acetyl]piperidine-4-carboxylate (PubChem CID 55353705) has the molecular formula C19H26ClN3O3 and a molecular weight of 379.89 g/mol. Its IUPAC name is methyl 1-[2-[4-(2-chlorophenyl)piperazin-1-yl]acetyl]piperidine-4-carboxylate.
| Compound Name | methyl 1-[2-[4-(2-chlorophenyl)piperazin-1-yl]acetyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 55353705 |
| Molecular Formula | C19H26ClN3O3 |
| Molecular Weight | 379.89 g/mol |
| Exact Mass | 379.17 |
| IUPAC Name | methyl 1-[2-[4-(2-chlorophenyl)piperazin-1-yl]acetyl]piperidine-4-carboxylate |
| SMILES | COC(=O)C1CCN(C(=O)CN2CCN(c3ccccc3Cl)CC2)CC1 |
| InChI | InChI=1S/C19H26ClN3O3/c1-26-19(25)15-6-8-23(9-7-15)18(24)14-21-10-12-22(13-11-21)17-5-3-2-4-16(17)20/h2-5,15H,6-14H2,1H3 |
| InChIKey | MHSYBRGNWXYVRJ-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.89 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |