C14H20N2OS — CID 112727360
1-[4-(thiophen-2-ylmethyl)-1,4-diazepan-1-yl]but-2-en-1-one (PubChem CID 112727360) has the molecular formula C14H20N2OS and a molecular weight of 264.39 g/mol. Its IUPAC name is 1-[4-(thiophen-2-ylmethyl)-1,4-diazepan-1-yl]but-2-en-1-one.
| Compound Name | 1-[4-(thiophen-2-ylmethyl)-1,4-diazepan-1-yl]but-2-en-1-one |
|---|---|
| PubChem CID | 112727360 |
| Molecular Formula | C14H20N2OS |
| Molecular Weight | 264.39 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | 1-[4-(thiophen-2-ylmethyl)-1,4-diazepan-1-yl]but-2-en-1-one |
| SMILES | CC=CC(=O)N1CCCN(Cc2cccs2)CC1 |
| InChI | InChI=1S/C14H20N2OS/c1-2-5-14(17)16-8-4-7-15(9-10-16)12-13-6-3-11-18-13/h2-3,5-6,11H,4,7-10,12H2,1H3 |
| InChIKey | OFMUDNUYUVUEQB-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.39 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|