C14H21ClN2OS — CID 62727225
3-chloro-2-methyl-1-[4-(thiophen-2-ylmethyl)-1,4-diazepan-1-yl]propan-1-one (PubChem CID 62727225) has the molecular formula C14H21ClN2OS and a molecular weight of 300.85 g/mol. Its IUPAC name is 3-chloro-2-methyl-1-[4-(thiophen-2-ylmethyl)-1,4-diazepan-1-yl]propan-1-one.
| Compound Name | 3-chloro-2-methyl-1-[4-(thiophen-2-ylmethyl)-1,4-diazepan-1-yl]propan-1-one |
|---|---|
| PubChem CID | 62727225 |
| Molecular Formula | C14H21ClN2OS |
| Molecular Weight | 300.85 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | 3-chloro-2-methyl-1-[4-(thiophen-2-ylmethyl)-1,4-diazepan-1-yl]propan-1-one |
| SMILES | CC(CCl)C(=O)N1CCCN(Cc2cccs2)CC1 |
| InChI | InChI=1S/C14H21ClN2OS/c1-12(10-15)14(18)17-6-3-5-16(7-8-17)11-13-4-2-9-19-13/h2,4,9,12H,3,5-8,10-11H2,1H3 |
| InChIKey | FRDYRXXLHQZZCN-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.85 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|