C18H22N2O3S3 — CID 46566261
2-(4-methylphenyl)sulfanyl-1-[4-(5-methylthiophen-2-yl)sulfonylpiperazin-1-yl]ethanone (PubChem CID 46566261) has the molecular formula C18H22N2O3S3 and a molecular weight of 410.59 g/mol. Its IUPAC name is 2-(4-methylphenyl)sulfanyl-1-[4-(5-methylthiophen-2-yl)sulfonylpiperazin-1-yl]ethanone.
| Compound Name | 2-(4-methylphenyl)sulfanyl-1-[4-(5-methylthiophen-2-yl)sulfonylpiperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 46566261 |
| Molecular Formula | C18H22N2O3S3 |
| Molecular Weight | 410.59 g/mol |
| Exact Mass | 410.08 |
| IUPAC Name | 2-(4-methylphenyl)sulfanyl-1-[4-(5-methylthiophen-2-yl)sulfonylpiperazin-1-yl]ethanone |
| SMILES | Cc1ccc(SCC(=O)N2CCN(S(=O)(=O)c3ccc(C)s3)CC2)cc1 |
| InChI | InChI=1S/C18H22N2O3S3/c1-14-3-6-16(7-4-14)24-13-17(21)19-9-11-20(12-10-19)26(22,23)18-8-5-15(2)25-18/h3-8H,9-13H2,1-2H3 |
| InChIKey | GGAIBHNBVHCQMV-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.59 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |