C18H26FN3O3S — CID 39626456
2-[4-(2-fluoro-5-methylphenyl)sulfonylpiperazin-1-yl]-1-piperidin-1-ylethanone (PubChem CID 39626456) has the molecular formula C18H26FN3O3S and a molecular weight of 383.49 g/mol. Its IUPAC name is 2-[4-(2-fluoro-5-methylphenyl)sulfonylpiperazin-1-yl]-1-piperidin-1-ylethanone.
| Compound Name | 2-[4-(2-fluoro-5-methylphenyl)sulfonylpiperazin-1-yl]-1-piperidin-1-ylethanone |
|---|---|
| PubChem CID | 39626456 |
| Molecular Formula | C18H26FN3O3S |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | 2-[4-(2-fluoro-5-methylphenyl)sulfonylpiperazin-1-yl]-1-piperidin-1-ylethanone |
| SMILES | Cc1ccc(F)c(S(=O)(=O)N2CCN(CC(=O)N3CCCCC3)CC2)c1 |
| InChI | InChI=1S/C18H26FN3O3S/c1-15-5-6-16(19)17(13-15)26(24,25)22-11-9-20(10-12-22)14-18(23)21-7-3-2-4-8-21/h5-6,13H,2-4,7-12,14H2,1H3 |
| InChIKey | JWUWPOGWNXQNOG-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |