C19H31N3O3S — CID 51242936
N-tert-butyl-2-[4-(2,5-dimethylphenyl)sulfonylpiperazin-1-yl]propanamide (PubChem CID 51242936) has the molecular formula C19H31N3O3S and a molecular weight of 381.54 g/mol. Its IUPAC name is N-tert-butyl-2-[4-(2,5-dimethylphenyl)sulfonylpiperazin-1-yl]propanamide.
| Compound Name | N-tert-butyl-2-[4-(2,5-dimethylphenyl)sulfonylpiperazin-1-yl]propanamide |
|---|---|
| PubChem CID | 51242936 |
| Molecular Formula | C19H31N3O3S |
| Molecular Weight | 381.54 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | N-tert-butyl-2-[4-(2,5-dimethylphenyl)sulfonylpiperazin-1-yl]propanamide |
| SMILES | Cc1ccc(C)c(S(=O)(=O)N2CCN(C(C)C(=O)NC(C)(C)C)CC2)c1 |
| InChI | InChI=1S/C19H31N3O3S/c1-14-7-8-15(2)17(13-14)26(24,25)22-11-9-21(10-12-22)16(3)18(23)20-19(4,5)6/h7-8,13,16H,9-12H2,1-6H3,(H,20,23) |
| InChIKey | QSNOSPURFDTFQI-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.54 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |