C19H25N3O4S2 — CID 41191153
1-methyl-3-[(5-morpholin-4-ylsulfonylthiophen-2-yl)methyl]-1-[(1R)-1-phenylethyl]urea (PubChem CID 41191153) has the molecular formula C19H25N3O4S2 and a molecular weight of 423.56 g/mol. Its IUPAC name is 1-methyl-3-[(5-morpholin-4-ylsulfonylthiophen-2-yl)methyl]-1-[(1R)-1-phenylethyl]urea.
| Compound Name | 1-methyl-3-[(5-morpholin-4-ylsulfonylthiophen-2-yl)methyl]-1-[(1R)-1-phenylethyl]urea |
|---|---|
| PubChem CID | 41191153 |
| Molecular Formula | C19H25N3O4S2 |
| Molecular Weight | 423.56 g/mol |
| Exact Mass | 423.13 |
| IUPAC Name | 1-methyl-3-[(5-morpholin-4-ylsulfonylthiophen-2-yl)methyl]-1-[(1R)-1-phenylethyl]urea |
| SMILES | C[C@H](c1ccccc1)N(C)C(=O)NCc1ccc(S(=O)(=O)N2CCOCC2)s1 |
| InChI | InChI=1S/C19H25N3O4S2/c1-15(16-6-4-3-5-7-16)21(2)19(23)20-14-17-8-9-18(27-17)28(24,25)22-10-12-26-13-11-22/h3-9,15H,10-14H2,1-2H3,(H,20,23)/t15-/m1/s1 |
| InChIKey | ZYNAHIVITKOUAX-OAHLLOKOSA-N |
| XLogP | 2.67 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.56 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |