C14H20ClN3O3S — CID 26567609
N-[(2-chlorophenyl)methyl]-2-(4-methylsulfonylpiperazin-1-yl)acetamide (PubChem CID 26567609) has the molecular formula C14H20ClN3O3S and a molecular weight of 345.85 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methyl]-2-(4-methylsulfonylpiperazin-1-yl)acetamide.
| Compound Name | N-[(2-chlorophenyl)methyl]-2-(4-methylsulfonylpiperazin-1-yl)acetamide |
|---|---|
| PubChem CID | 26567609 |
| Molecular Formula | C14H20ClN3O3S |
| Molecular Weight | 345.85 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | N-[(2-chlorophenyl)methyl]-2-(4-methylsulfonylpiperazin-1-yl)acetamide |
| SMILES | CS(=O)(=O)N1CCN(CC(=O)NCc2ccccc2Cl)CC1 |
| InChI | InChI=1S/C14H20ClN3O3S/c1-22(20,21)18-8-6-17(7-9-18)11-14(19)16-10-12-4-2-3-5-13(12)15/h2-5H,6-11H2,1H3,(H,16,19) |
| InChIKey | BOCFSALULHYKNL-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.85 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |