C17H18F2N2O4S2 — CID 7941191
N-[4-(difluoromethoxy)phenyl]-2-(5-pyrrolidin-1-ylsulfonylthiophen-2-yl)acetamide (PubChem CID 7941191) has the molecular formula C17H18F2N2O4S2 and a molecular weight of 416.47 g/mol. Its IUPAC name is N-[4-(difluoromethoxy)phenyl]-2-(5-pyrrolidin-1-ylsulfonylthiophen-2-yl)acetamide.
| Compound Name | N-[4-(difluoromethoxy)phenyl]-2-(5-pyrrolidin-1-ylsulfonylthiophen-2-yl)acetamide |
|---|---|
| PubChem CID | 7941191 |
| Molecular Formula | C17H18F2N2O4S2 |
| Molecular Weight | 416.47 g/mol |
| Exact Mass | 416.07 |
| IUPAC Name | N-[4-(difluoromethoxy)phenyl]-2-(5-pyrrolidin-1-ylsulfonylthiophen-2-yl)acetamide |
| SMILES | O=C(Cc1ccc(S(=O)(=O)N2CCCC2)s1)Nc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C17H18F2N2O4S2/c18-17(19)25-13-5-3-12(4-6-13)20-15(22)11-14-7-8-16(26-14)27(23,24)21-9-1-2-10-21/h3-8,17H,1-2,9-11H2,(H,20,22) |
| InChIKey | MJGCIHGUQGDUTH-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.47 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |