C21H25F2N3O3S2 — CID 55836799
N-(3,5-difluoro-4-pyrrolidin-1-ylphenyl)-2-(5-piperidin-1-ylsulfonylthiophen-2-yl)acetamide (PubChem CID 55836799) has the molecular formula C21H25F2N3O3S2 and a molecular weight of 469.58 g/mol. Its IUPAC name is N-(3,5-difluoro-4-pyrrolidin-1-ylphenyl)-2-(5-piperidin-1-ylsulfonylthiophen-2-yl)acetamide.
| Compound Name | N-(3,5-difluoro-4-pyrrolidin-1-ylphenyl)-2-(5-piperidin-1-ylsulfonylthiophen-2-yl)acetamide |
|---|---|
| PubChem CID | 55836799 |
| Molecular Formula | C21H25F2N3O3S2 |
| Molecular Weight | 469.58 g/mol |
| Exact Mass | 469.13 |
| IUPAC Name | N-(3,5-difluoro-4-pyrrolidin-1-ylphenyl)-2-(5-piperidin-1-ylsulfonylthiophen-2-yl)acetamide |
| SMILES | O=C(Cc1ccc(S(=O)(=O)N2CCCCC2)s1)Nc1cc(F)c(N2CCCC2)c(F)c1 |
| InChI | InChI=1S/C21H25F2N3O3S2/c22-17-12-15(13-18(23)21(17)25-8-4-5-9-25)24-19(27)14-16-6-7-20(30-16)31(28,29)26-10-2-1-3-11-26/h6-7,12-13H,1-5,8-11,14H2,(H,24,27) |
| InChIKey | PDVQWTCVWJXMMU-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.58 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|