C16H20N4O3S2 — CID 119515991
N-(6-amino-3-pyridinyl)-2-(5-piperidin-1-ylsulfonylthiophen-2-yl)acetamide (PubChem CID 119515991) has the molecular formula C16H20N4O3S2 and a molecular weight of 380.50 g/mol. Its IUPAC name is N-(6-amino-3-pyridinyl)-2-(5-piperidin-1-ylsulfonylthiophen-2-yl)acetamide.
| Compound Name | N-(6-amino-3-pyridinyl)-2-(5-piperidin-1-ylsulfonylthiophen-2-yl)acetamide |
|---|---|
| PubChem CID | 119515991 |
| Molecular Formula | C16H20N4O3S2 |
| Molecular Weight | 380.50 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | N-(6-amino-3-pyridinyl)-2-(5-piperidin-1-ylsulfonylthiophen-2-yl)acetamide |
| SMILES | Nc1ccc(NC(=O)Cc2ccc(S(=O)(=O)N3CCCCC3)s2)cn1 |
| InChI | InChI=1S/C16H20N4O3S2/c17-14-6-4-12(11-18-14)19-15(21)10-13-5-7-16(24-13)25(22,23)20-8-2-1-3-9-20/h4-7,11H,1-3,8-10H2,(H2,17,18)(H,19,21) |
| InChIKey | UKEGCYSJGDWRPL-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 105.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.50 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |