C21H25N3O6S2 — CID 23770843
[2-(4-acetamidoanilino)-2-oxoethyl] 2-(5-piperidin-1-ylsulfonylthiophen-2-yl)acetate (PubChem CID 23770843) has the molecular formula C21H25N3O6S2 and a molecular weight of 479.58 g/mol. Its IUPAC name is [2-(4-acetamidoanilino)-2-oxoethyl] 2-(5-piperidin-1-ylsulfonylthiophen-2-yl)acetate.
| Compound Name | [2-(4-acetamidoanilino)-2-oxoethyl] 2-(5-piperidin-1-ylsulfonylthiophen-2-yl)acetate |
|---|---|
| PubChem CID | 23770843 |
| Molecular Formula | C21H25N3O6S2 |
| Molecular Weight | 479.58 g/mol |
| Exact Mass | 479.12 |
| IUPAC Name | [2-(4-acetamidoanilino)-2-oxoethyl] 2-(5-piperidin-1-ylsulfonylthiophen-2-yl)acetate |
| SMILES | CC(=O)Nc1ccc(NC(=O)COC(=O)Cc2ccc(S(=O)(=O)N3CCCCC3)s2)cc1 |
| InChI | InChI=1S/C21H25N3O6S2/c1-15(25)22-16-5-7-17(8-6-16)23-19(26)14-30-20(27)13-18-9-10-21(31-18)32(28,29)24-11-3-2-4-12-24/h5-10H,2-4,11-14H2,1H3,(H,22,25)(H,23,26) |
| InChIKey | SQBFVQFYFCLIGC-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.58 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |