C18H25N3O6S — CID 7197704
[2-oxo-2-(4-piperidin-1-ylsulfonylanilino)ethyl] 3-acetamidopropanoate (PubChem CID 7197704) has the molecular formula C18H25N3O6S and a molecular weight of 411.48 g/mol. Its IUPAC name is [2-oxo-2-(4-piperidin-1-ylsulfonylanilino)ethyl] 3-acetamidopropanoate.
| Compound Name | [2-oxo-2-(4-piperidin-1-ylsulfonylanilino)ethyl] 3-acetamidopropanoate |
|---|---|
| PubChem CID | 7197704 |
| Molecular Formula | C18H25N3O6S |
| Molecular Weight | 411.48 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | [2-oxo-2-(4-piperidin-1-ylsulfonylanilino)ethyl] 3-acetamidopropanoate |
| SMILES | CC(=O)NCCC(=O)OCC(=O)Nc1ccc(S(=O)(=O)N2CCCCC2)cc1 |
| InChI | InChI=1S/C18H25N3O6S/c1-14(22)19-10-9-18(24)27-13-17(23)20-15-5-7-16(8-6-15)28(25,26)21-11-3-2-4-12-21/h5-8H,2-4,9-13H2,1H3,(H,19,22)(H,20,23) |
| InChIKey | KACWUURKXUVBFU-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.48 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |