C17H17F3N2O3S2 — CID 26087846
2-(5-pyrrolidin-1-ylsulfonylthiophen-2-yl)-N-[3-(trifluoromethyl)phenyl]acetamide (PubChem CID 26087846) has the molecular formula C17H17F3N2O3S2 and a molecular weight of 418.46 g/mol. Its IUPAC name is 2-(5-pyrrolidin-1-ylsulfonylthiophen-2-yl)-N-[3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-(5-pyrrolidin-1-ylsulfonylthiophen-2-yl)-N-[3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 26087846 |
| Molecular Formula | C17H17F3N2O3S2 |
| Molecular Weight | 418.46 g/mol |
| Exact Mass | 418.06 |
| IUPAC Name | 2-(5-pyrrolidin-1-ylsulfonylthiophen-2-yl)-N-[3-(trifluoromethyl)phenyl]acetamide |
| SMILES | O=C(Cc1ccc(S(=O)(=O)N2CCCC2)s1)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H17F3N2O3S2/c18-17(19,20)12-4-3-5-13(10-12)21-15(23)11-14-6-7-16(26-14)27(24,25)22-8-1-2-9-22/h3-7,10H,1-2,8-9,11H2,(H,21,23) |
| InChIKey | MNUGRHYDTCRCOF-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.46 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |