C18H20BrFN2O3S2 — CID 55900603
N-[(2-bromo-5-fluorophenyl)methyl]-2-(5-piperidin-1-ylsulfonylthiophen-2-yl)acetamide (PubChem CID 55900603) has the molecular formula C18H20BrFN2O3S2 and a molecular weight of 475.41 g/mol. Its IUPAC name is N-[(2-bromo-5-fluorophenyl)methyl]-2-(5-piperidin-1-ylsulfonylthiophen-2-yl)acetamide.
| Compound Name | N-[(2-bromo-5-fluorophenyl)methyl]-2-(5-piperidin-1-ylsulfonylthiophen-2-yl)acetamide |
|---|---|
| PubChem CID | 55900603 |
| Molecular Formula | C18H20BrFN2O3S2 |
| Molecular Weight | 475.41 g/mol |
| Exact Mass | 474.01 |
| IUPAC Name | N-[(2-bromo-5-fluorophenyl)methyl]-2-(5-piperidin-1-ylsulfonylthiophen-2-yl)acetamide |
| SMILES | O=C(Cc1ccc(S(=O)(=O)N2CCCCC2)s1)NCc1cc(F)ccc1Br |
| InChI | InChI=1S/C18H20BrFN2O3S2/c19-16-6-4-14(20)10-13(16)12-21-17(23)11-15-5-7-18(26-15)27(24,25)22-8-2-1-3-9-22/h4-7,10H,1-3,8-9,11-12H2,(H,21,23) |
| InChIKey | VPGZGXRHKOJCDD-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.41 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |