C18H21FN2O3S2 — CID 34741191
N-(2-fluoro-4-methylphenyl)-2-(5-piperidin-1-ylsulfonylthiophen-2-yl)acetamide (PubChem CID 34741191) has the molecular formula C18H21FN2O3S2 and a molecular weight of 396.51 g/mol. Its IUPAC name is N-(2-fluoro-4-methylphenyl)-2-(5-piperidin-1-ylsulfonylthiophen-2-yl)acetamide.
| Compound Name | N-(2-fluoro-4-methylphenyl)-2-(5-piperidin-1-ylsulfonylthiophen-2-yl)acetamide |
|---|---|
| PubChem CID | 34741191 |
| Molecular Formula | C18H21FN2O3S2 |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.10 |
| IUPAC Name | N-(2-fluoro-4-methylphenyl)-2-(5-piperidin-1-ylsulfonylthiophen-2-yl)acetamide |
| SMILES | Cc1ccc(NC(=O)Cc2ccc(S(=O)(=O)N3CCCCC3)s2)c(F)c1 |
| InChI | InChI=1S/C18H21FN2O3S2/c1-13-5-7-16(15(19)11-13)20-17(22)12-14-6-8-18(25-14)26(23,24)21-9-3-2-4-10-21/h5-8,11H,2-4,9-10,12H2,1H3,(H,20,22) |
| InChIKey | XNMXVLUZVZHWGW-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |