C20H17F2NO6S2 — CID 30137420
[4-(difluoromethoxy)-3-methoxyphenyl]methyl 2-(thiophen-2-ylsulfonylamino)benzoate (PubChem CID 30137420) has the molecular formula C20H17F2NO6S2 and a molecular weight of 469.49 g/mol. Its IUPAC name is [4-(difluoromethoxy)-3-methoxyphenyl]methyl 2-(thiophen-2-ylsulfonylamino)benzoate.
| Compound Name | [4-(difluoromethoxy)-3-methoxyphenyl]methyl 2-(thiophen-2-ylsulfonylamino)benzoate |
|---|---|
| PubChem CID | 30137420 |
| Molecular Formula | C20H17F2NO6S2 |
| Molecular Weight | 469.49 g/mol |
| Exact Mass | 469.05 |
| IUPAC Name | [4-(difluoromethoxy)-3-methoxyphenyl]methyl 2-(thiophen-2-ylsulfonylamino)benzoate |
| SMILES | COc1cc(COC(=O)c2ccccc2NS(=O)(=O)c2cccs2)ccc1OC(F)F |
| InChI | InChI=1S/C20H17F2NO6S2/c1-27-17-11-13(8-9-16(17)29-20(21)22)12-28-19(24)14-5-2-3-6-15(14)23-31(25,26)18-7-4-10-30-18/h2-11,20,23H,12H2,1H3 |
| InChIKey | BWRATVARACQEND-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.49 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |