C12H11F2NO3S2 — CID 19684078
N-[2-(difluoromethoxy)-5-methylphenyl]thiophene-2-sulfonamide (PubChem CID 19684078) has the molecular formula C12H11F2NO3S2 and a molecular weight of 319.35 g/mol. Its IUPAC name is N-[2-(difluoromethoxy)-5-methylphenyl]thiophene-2-sulfonamide.
| Compound Name | N-[2-(difluoromethoxy)-5-methylphenyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 19684078 |
| Molecular Formula | C12H11F2NO3S2 |
| Molecular Weight | 319.35 g/mol |
| Exact Mass | 319.01 |
| IUPAC Name | N-[2-(difluoromethoxy)-5-methylphenyl]thiophene-2-sulfonamide |
| SMILES | Cc1ccc(OC(F)F)c(NS(=O)(=O)c2cccs2)c1 |
| InChI | InChI=1S/C12H11F2NO3S2/c1-8-4-5-10(18-12(13)14)9(7-8)15-20(16,17)11-3-2-6-19-11/h2-7,12,15H,1H3 |
| InChIKey | NXUINDJTXXIOJC-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.35 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |