C15H15F2NO3S — CID 19684072
N-[2-(difluoromethoxy)-5-methylphenyl]-1-phenylmethanesulfonamide (PubChem CID 19684072) has the molecular formula C15H15F2NO3S and a molecular weight of 327.35 g/mol. Its IUPAC name is N-[2-(difluoromethoxy)-5-methylphenyl]-1-phenylmethanesulfonamide.
| Compound Name | N-[2-(difluoromethoxy)-5-methylphenyl]-1-phenylmethanesulfonamide |
|---|---|
| PubChem CID | 19684072 |
| Molecular Formula | C15H15F2NO3S |
| Molecular Weight | 327.35 g/mol |
| Exact Mass | 327.07 |
| IUPAC Name | N-[2-(difluoromethoxy)-5-methylphenyl]-1-phenylmethanesulfonamide |
| SMILES | Cc1ccc(OC(F)F)c(NS(=O)(=O)Cc2ccccc2)c1 |
| InChI | InChI=1S/C15H15F2NO3S/c1-11-7-8-14(21-15(16)17)13(9-11)18-22(19,20)10-12-5-3-2-4-6-12/h2-9,15,18H,10H2,1H3 |
| InChIKey | CQMYPPPGDKAZGB-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.35 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |