C14H10Cl3F2NO3S — CID 19684098
2,4,5-trichloro-N-[2-(difluoromethoxy)-5-methylphenyl]benzenesulfonamide (PubChem CID 19684098) has the molecular formula C14H10Cl3F2NO3S and a molecular weight of 416.66 g/mol. Its IUPAC name is 2,4,5-trichloro-N-[2-(difluoromethoxy)-5-methylphenyl]benzenesulfonamide.
| Compound Name | 2,4,5-trichloro-N-[2-(difluoromethoxy)-5-methylphenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 19684098 |
| Molecular Formula | C14H10Cl3F2NO3S |
| Molecular Weight | 416.66 g/mol |
| Exact Mass | 414.94 |
| IUPAC Name | 2,4,5-trichloro-N-[2-(difluoromethoxy)-5-methylphenyl]benzenesulfonamide |
| SMILES | Cc1ccc(OC(F)F)c(NS(=O)(=O)c2cc(Cl)c(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C14H10Cl3F2NO3S/c1-7-2-3-12(23-14(18)19)11(4-7)20-24(21,22)13-6-9(16)8(15)5-10(13)17/h2-6,14,20H,1H3 |
| InChIKey | FKFLXELUPGFTSQ-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.66 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|